C27H27N5O6 — CID 158644163
8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]-2-oxoethyl]chromen-2-one (PubChem CID 158644163) has the molecular formula C27H27N5O6 and a molecular weight of 517.54 g/mol. Its IUPAC name is 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]-2-oxoethyl]chromen-2-one.
| Compound Name | 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]-2-oxoethyl]chromen-2-one |
|---|---|
| PubChem CID | 158644163 |
| Molecular Formula | C27H27N5O6 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]-2-oxoethyl]chromen-2-one |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(CC(=O)c3cn(Cc4ccc([N+](=O)[O-])cc4)nn3)c(=O)oc12 |
| InChI | InChI=1S/C27H27N5O6/c1-17-25(37-22-9-11-30(2)12-10-22)8-5-19-13-20(27(34)38-26(17)19)14-24(33)23-16-31(29-28-23)15-18-3-6-21(7-4-18)32(35)36/h3-8,13,16,22H,9-12,14-15H2,1-2H3 |
| InChIKey | IATIVJDQOWLZLL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 133.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|