C27H28F3NO5 — CID 160742843
8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-oxo-4-[4-(trifluoromethoxy)phenyl]butyl]chromen-2-one (PubChem CID 160742843) has the molecular formula C27H28F3NO5 and a molecular weight of 503.52 g/mol. Its IUPAC name is 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-oxo-4-[4-(trifluoromethoxy)phenyl]butyl]chromen-2-one.
| Compound Name | 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-oxo-4-[4-(trifluoromethoxy)phenyl]butyl]chromen-2-one |
|---|---|
| PubChem CID | 160742843 |
| Molecular Formula | C27H28F3NO5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 8-methyl-7-(1-methylpiperidin-4-yl)oxy-3-[2-oxo-4-[4-(trifluoromethoxy)phenyl]butyl]chromen-2-one |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(CC(=O)CCc3ccc(OC(F)(F)F)cc3)c(=O)oc12 |
| InChI | InChI=1S/C27H28F3NO5/c1-17-24(34-22-11-13-31(2)14-12-22)10-6-19-15-20(26(33)35-25(17)19)16-21(32)7-3-18-4-8-23(9-5-18)36-27(28,29)30/h4-6,8-10,15,22H,3,7,11-14,16H2,1-2H3 |
| InChIKey | RVUSKHLIHWZAST-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|