C22H30N4O4 — CID 118063803
4-methyl-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]piperazine-1-carboxamide (PubChem CID 118063803) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-methyl-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]piperazine-1-carboxamide.
| Compound Name | 4-methyl-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 118063803 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-methyl-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]piperazine-1-carboxamide |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(NC(=O)N3CCN(C)CC3)c(=O)oc12 |
| InChI | InChI=1S/C22H30N4O4/c1-15-19(29-17-6-8-24(2)9-7-17)5-4-16-14-18(21(27)30-20(15)16)23-22(28)26-12-10-25(3)11-13-26/h4-5,14,17H,6-13H2,1-3H3,(H,23,28) |
| InChIKey | RPZOVXPVPKQNKS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|