C31H35N3O4 — CID 144843329
1,1-dibenzyl-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea;molecular hydrogen (PubChem CID 144843329) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea;molecular hydrogen.
| Compound Name | 1,1-dibenzyl-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 144843329 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 1,1-dibenzyl-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea;molecular hydrogen |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(NC(=O)N(Cc3ccccc3)Cc3ccccc3)c(=O)oc12.[H][H] |
| InChI | InChI=1S/C31H33N3O4.H2/c1-22-28(37-26-15-17-33(2)18-16-26)14-13-25-19-27(30(35)38-29(22)25)32-31(36)34(20-23-9-5-3-6-10-23)21-24-11-7-4-8-12-24;/h3-14,19,26H,15-18,20-21H2,1-2H3,(H,32,36);1H |
| InChIKey | NQZRFSKKRONLAK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|