C24H26ClN3O4 — CID 118064211
1-(4-chloro-3-methylphenyl)-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea (PubChem CID 118064211) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 118064211 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cc3ccc(OC4CCN(C)CC4)c(C)c3oc2=O)ccc1Cl |
| InChI | InChI=1S/C24H26ClN3O4/c1-14-12-17(5-6-19(14)25)26-24(30)27-20-13-16-4-7-21(15(2)22(16)32-23(20)29)31-18-8-10-28(3)11-9-18/h4-7,12-13,18H,8-11H2,1-3H3,(H2,26,27,30) |
| InChIKey | UEUQLJHAGJNBIG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|