C26H28ClNO4 — CID 146880498
3-[4-(4-chlorophenyl)-2-oxobutyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one (PubChem CID 146880498) has the molecular formula C26H28ClNO4 and a molecular weight of 453.97 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2-oxobutyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one.
| Compound Name | 3-[4-(4-chlorophenyl)-2-oxobutyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
|---|---|
| PubChem CID | 146880498 |
| Molecular Formula | C26H28ClNO4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2-oxobutyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(CC(=O)CCc3ccc(Cl)cc3)c(=O)oc12 |
| InChI | InChI=1S/C26H28ClNO4/c1-17-24(31-23-11-13-28(2)14-12-23)10-6-19-15-20(26(30)32-25(17)19)16-22(29)9-5-18-3-7-21(27)8-4-18/h3-4,6-8,10,15,23H,5,9,11-14,16H2,1-2H3 |
| InChIKey | SSOJWGFMCHFTAF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|