C21H27N3O4 — CID 40533213
(2R,3S,4R,5R)-2-[2-[(3,4-dimethylphenyl)diazenyl]-4,5-dimethylanilino]oxane-3,4,5-triol (PubChem CID 40533213) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[2-[(3,4-dimethylphenyl)diazenyl]-4,5-dimethylanilino]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-[2-[(3,4-dimethylphenyl)diazenyl]-4,5-dimethylanilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 40533213 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R,3S,4R,5R)-2-[2-[(3,4-dimethylphenyl)diazenyl]-4,5-dimethylanilino]oxane-3,4,5-triol |
| SMILES | Cc1ccc(/N=N/c2cc(C)c(C)cc2N[C@@H]2OC[C@@H](O)[C@@H](O)[C@@H]2O)cc1C |
| InChI | InChI=1S/C21H27N3O4/c1-11-5-6-15(7-12(11)2)23-24-17-9-14(4)13(3)8-16(17)22-21-20(27)19(26)18(25)10-28-21/h5-9,18-22,25-27H,10H2,1-4H3/b24-23+/t18-,19-,20+,21-/m1/s1 |
| InChIKey | JBNSPOAEDLTUGT-OWVIKCAUSA-N |
| XLogP | 3.19 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|