C9H16N4O4 — CID 89143772
3-(diaminomethylidene)-1-ethenyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea (PubChem CID 89143772) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-ethenyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea.
| Compound Name | 3-(diaminomethylidene)-1-ethenyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
|---|---|
| PubChem CID | 89143772 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-(diaminomethylidene)-1-ethenyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
| SMILES | C=CN(C(=O)N=C(N)N)C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C9H16N4O4/c1-2-13(9(16)12-8(10)11)7-3-5(15)6(4-14)17-7/h2,5-7,14-15H,1,3-4H2,(H4,10,11,12,16) |
| InChIKey | YISJJCMFAHLIHH-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|