C11H17ClF2N2O5 — CID 144900733
1-[(E)-2-chloro-3-oxoprop-1-enyl]-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea;difluoromethane (PubChem CID 144900733) has the molecular formula C11H17ClF2N2O5 and a molecular weight of 330.72 g/mol. Its IUPAC name is 1-[(E)-2-chloro-3-oxoprop-1-enyl]-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea;difluoromethane.
| Compound Name | 1-[(E)-2-chloro-3-oxoprop-1-enyl]-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea;difluoromethane |
|---|---|
| PubChem CID | 144900733 |
| Molecular Formula | C11H17ClF2N2O5 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[(E)-2-chloro-3-oxoprop-1-enyl]-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea;difluoromethane |
| SMILES | CNC(=O)N(/C=C(/Cl)C=O)C1CC(O)C(CO)O1.FCF |
| InChI | InChI=1S/C10H15ClN2O5.CH2F2/c1-12-10(17)13(3-6(11)4-14)9-2-7(16)8(5-15)18-9;2-1-3/h3-4,7-9,15-16H,2,5H2,1H3,(H,12,17);1H2/b6-3+; |
| InChIKey | CJGUKRVVDNKOMF-ZIKNSQGESA-N |
| XLogP | 0.26 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|