C14H23N3O7 — CID 121487145
[[(2S,3R,4R,5R)-2-(hydroxymethyl)-4-methoxy-5-[methylcarbamoyl-[(Z)-2-methyl-3-oxoprop-1-enyl]amino]oxolan-3-yl]amino] acetate (PubChem CID 121487145) has the molecular formula C14H23N3O7 and a molecular weight of 345.35 g/mol. Its IUPAC name is [[(2S,3R,4R,5R)-2-(hydroxymethyl)-4-methoxy-5-[methylcarbamoyl-[(Z)-2-methyl-3-oxoprop-1-enyl]amino]oxolan-3-yl]amino] acetate.
| Compound Name | [[(2S,3R,4R,5R)-2-(hydroxymethyl)-4-methoxy-5-[methylcarbamoyl-[(Z)-2-methyl-3-oxoprop-1-enyl]amino]oxolan-3-yl]amino] acetate |
|---|---|
| PubChem CID | 121487145 |
| Molecular Formula | C14H23N3O7 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [[(2S,3R,4R,5R)-2-(hydroxymethyl)-4-methoxy-5-[methylcarbamoyl-[(Z)-2-methyl-3-oxoprop-1-enyl]amino]oxolan-3-yl]amino] acetate |
| SMILES | CNC(=O)N(/C=C(/C)C=O)[C@@H]1O[C@H](CO)[C@@H](NOC(C)=O)[C@H]1OC |
| InChI | InChI=1S/C14H23N3O7/c1-8(6-18)5-17(14(21)15-3)13-12(22-4)11(10(7-19)23-13)16-24-9(2)20/h5-6,10-13,16,19H,7H2,1-4H3,(H,15,21)/b8-5-/t10-,11-,12-,13-/m1/s1 |
| InChIKey | UPNSADSNNHGELS-ZJZFEFHWSA-N |
| XLogP | -1.10 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|