C11H17N3O6 — CID 121487271
1-[(2R,3E,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyiminooxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea (PubChem CID 121487271) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-[(2R,3E,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyiminooxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[(2R,3E,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyiminooxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 121487271 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[(2R,3E,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyiminooxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
| SMILES | CNC(=O)N(/C=C\C=O)[C@@H]1O[C@H](CO)[C@@H](O)/C1=N\OC |
| InChI | InChI=1S/C11H17N3O6/c1-12-11(18)14(4-3-5-15)10-8(13-19-2)9(17)7(6-16)20-10/h3-5,7,9-10,16-17H,6H2,1-2H3,(H,12,18)/b4-3-,13-8+/t7-,9-,10-/m1/s1 |
| InChIKey | LLHVMQOIBJIAKG-LBIGSDKSSA-N |
| XLogP | -1.58 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|