C18H30N2O6 — CID 121487185
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oct-1-en-3-yloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea (PubChem CID 121487185) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oct-1-en-3-yloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oct-1-en-3-yloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 121487185 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oct-1-en-3-yloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
| SMILES | C=CC(CCCCC)[C@@]1(N(/C=C\C=O)C(=O)NC)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H30N2O6/c1-4-6-7-9-13(5-2)18(16(24)15(23)14(12-22)26-18)20(10-8-11-21)17(25)19-3/h5,8,10-11,13-16,22-24H,2,4,6-7,9,12H2,1,3H3,(H,19,25)/b10-8-/t13?,14-,15-,16-,18-/m1/s1 |
| InChIKey | NQWWBWZYDJQDLW-LBQCBNMWSA-N |
| XLogP | 0.53 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|