C12H20N2O4 — CID 144828931
1-[5-(methoxymethyl)-3-methyloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea (PubChem CID 144828931) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-[5-(methoxymethyl)-3-methyloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[5-(methoxymethyl)-3-methyloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 144828931 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[5-(methoxymethyl)-3-methyloxolan-2-yl]-3-methyl-1-[(Z)-3-oxoprop-1-enyl]urea |
| SMILES | CNC(=O)N(/C=C\C=O)C1OC(COC)CC1C |
| InChI | InChI=1S/C12H20N2O4/c1-9-7-10(8-17-3)18-11(9)14(5-4-6-15)12(16)13-2/h4-6,9-11H,7-8H2,1-3H3,(H,13,16)/b5-4- |
| InChIKey | CZEIGSQJUAIEMA-PLNGDYQASA-N |
| XLogP | 0.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|