About 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid
2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 18716202) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid.
Analyze 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid?
The IUPAC name of 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CID 18716202) is 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid.
What is the SMILES notation for 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid?
The canonical SMILES for 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid is COCC1CC(CC(=O)O)OC(C)(C)O1.
What is the InChIKey of 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid?
The InChIKey is ARKGXDGSLDYYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-10(2)14-7(5-9(11)12)4-8(15-10)6-13-3/h7-8H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid?
2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid has a molecular weight of 218.25 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(methoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid is sourced from PubChem (CID 18716202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).