C11H20FN2O13P3 — CID 144853823
[[5-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 144853823) has the molecular formula C11H20FN2O13P3 and a molecular weight of 500.20 g/mol. Its IUPAC name is [[5-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 144853823 |
| Molecular Formula | C11H20FN2O13P3 |
| Molecular Weight | 500.20 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | [[5-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1CC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC1N(C)/C=C(/F)C(=O)NC=O |
| InChI | InChI=1S/C11H20FN2O13P3/c1-7-3-8(25-11(7)14(2)4-9(12)10(16)13-6-15)5-24-29(20,21)27-30(22,23)26-28(17,18)19/h4,6-8,11H,3,5H2,1-2H3,(H,20,21)(H,22,23)(H,13,15,16)(H2,17,18,19)/b9-4+ |
| InChIKey | XIEBLDIKHXNLKT-RUDMXATFSA-N |
| XLogP | 0.10 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|