C8H14N3O13P3S — CID 155043167
[[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-thiadiazol-5-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155043167) has the molecular formula C8H14N3O13P3S and a molecular weight of 485.20 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-thiadiazol-5-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-thiadiazol-5-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155043167 |
| Molecular Formula | C8H14N3O13P3S |
| Molecular Weight | 485.20 g/mol |
| Exact Mass | 484.95 |
| IUPAC Name | [[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-thiadiazol-5-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)c1nsc([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]2O)n1 |
| InChI | InChI=1S/C8H14N3O13P3S/c9-6(13)7-10-8(28-11-7)5-4(12)1-3(22-5)2-21-26(17,18)24-27(19,20)23-25(14,15)16/h3-5,12H,1-2H2,(H2,9,13)(H,17,18)(H,19,20)(H2,14,15,16)/t3-,4+,5+/m0/s1 |
| InChIKey | NQUDQEAQDMEUND-VPENINKCSA-N |
| XLogP | -0.83 |
| TPSA | 258.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|