C9H16IN2O14P3 — CID 129286932
[[(2R,3R)-5-[[(E)-3-amino-2-iodo-3-oxoprop-1-enyl]-formylamino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129286932) has the molecular formula C9H16IN2O14P3 and a molecular weight of 596.05 g/mol. Its IUPAC name is [[(2R,3R)-5-[[(E)-3-amino-2-iodo-3-oxoprop-1-enyl]-formylamino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R)-5-[[(E)-3-amino-2-iodo-3-oxoprop-1-enyl]-formylamino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129286932 |
| Molecular Formula | C9H16IN2O14P3 |
| Molecular Weight | 596.05 g/mol |
| Exact Mass | 595.89 |
| IUPAC Name | [[(2R,3R)-5-[[(E)-3-amino-2-iodo-3-oxoprop-1-enyl]-formylamino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)/C(I)=C\N(C=O)C1C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C9H16IN2O14P3/c10-5(9(11)15)2-12(4-13)8-1-6(14)7(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h2,4,6-8,14H,1,3H2,(H2,11,15)(H,19,20)(H,21,22)(H2,16,17,18)/b5-2+/t6-,7-,8?/m1/s1 |
| InChIKey | GLJNRUCNGPSBNH-VOGVHSMISA-N |
| XLogP | -0.97 |
| TPSA | 252.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.05 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|