C10H17IN3O12P3 — CID 158369466
[[5-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 158369466) has the molecular formula C10H17IN3O12P3 and a molecular weight of 591.08 g/mol. Its IUPAC name is [[5-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 158369466 |
| Molecular Formula | C10H17IN3O12P3 |
| Molecular Weight | 591.08 g/mol |
| Exact Mass | 590.91 |
| IUPAC Name | [[5-(4-amino-5-iodo-2-methylidenepyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1N=C(N)C(I)=CN1C1CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H17IN3O12P3/c1-5-13-10(12)6(11)3-14(5)9-2-7(15)8(24-9)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h3,7-9,15H,1-2,4H2,(H2,12,13)(H,19,20)(H,21,22)(H2,16,17,18) |
| InChIKey | JGMDBVSMRLETDV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 230.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.08 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|