C10H20N3O12P3 — CID 166734192
[[(5R)-5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 166734192) has the molecular formula C10H20N3O12P3 and a molecular weight of 467.20 g/mol. Its IUPAC name is [[(5R)-5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(5R)-5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166734192 |
| Molecular Formula | C10H20N3O12P3 |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | [[(5R)-5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C/N=C(N)/C=C\N(C=O)[C@H]1CCC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H20N3O12P3/c1-12-9(11)4-5-13(7-14)10-3-2-8(23-10)6-22-27(18,19)25-28(20,21)24-26(15,16)17/h4-5,7-8,10H,2-3,6H2,1H3,(H2,11,12)(H,18,19)(H,20,21)(H2,15,16,17)/b5-4-/t8?,10-/m1/s1 |
| InChIKey | KCRNYZBTHASRFR-AZDKXLJASA-N |
| XLogP | -0.21 |
| TPSA | 227.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|