C10H17N2O13P3 — CID 118150973
[hydroxy-[[(2S,5R)-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 118150973) has the molecular formula C10H17N2O13P3 and a molecular weight of 466.17 g/mol. Its IUPAC name is [hydroxy-[[(2S,5R)-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2S,5R)-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118150973 |
| Molecular Formula | C10H17N2O13P3 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | [hydroxy-[[(2S,5R)-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | Cn1cc([C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H17N2O13P3/c1-12-4-7(9(13)11-10(12)14)8-3-2-6(23-8)5-22-27(18,19)25-28(20,21)24-26(15,16)17/h4,6,8H,2-3,5H2,1H3,(H,18,19)(H,20,21)(H,11,13,14)(H2,15,16,17)/t6-,8+/m0/s1 |
| InChIKey | JPAHJZYGCFTGLH-POYBYMJQSA-N |
| XLogP | -0.36 |
| TPSA | 223.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|