C11H16F3N2O13P3 — CID 118151176
[[(2S,5R)-5-[2,4-dioxo-1-(2,2,2-trifluoroethyl)pyrimidin-5-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118151176) has the molecular formula C11H16F3N2O13P3 and a molecular weight of 534.17 g/mol. Its IUPAC name is [[(2S,5R)-5-[2,4-dioxo-1-(2,2,2-trifluoroethyl)pyrimidin-5-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-[2,4-dioxo-1-(2,2,2-trifluoroethyl)pyrimidin-5-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118151176 |
| Molecular Formula | C11H16F3N2O13P3 |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | [[(2S,5R)-5-[2,4-dioxo-1-(2,2,2-trifluoroethyl)pyrimidin-5-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n(CC(F)(F)F)cc1[C@H]1CC[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C11H16F3N2O13P3/c12-11(13,14)5-16-3-7(9(17)15-10(16)18)8-2-1-6(27-8)4-26-31(22,23)29-32(24,25)28-30(19,20)21/h3,6,8H,1-2,4-5H2,(H,22,23)(H,24,25)(H,15,17,18)(H2,19,20,21)/t6-,8+/m0/s1 |
| InChIKey | NJEIQAFVQOUXGR-POYBYMJQSA-N |
| XLogP | 0.66 |
| TPSA | 223.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|