C16H27N2O15P3 — CID 175822383
[[(2R,3S,4R,5S)-5-[1-(cyclohexylmethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 175822383) has the molecular formula C16H27N2O15P3 and a molecular weight of 580.31 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[1-(cyclohexylmethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-[1-(cyclohexylmethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 175822383 |
| Molecular Formula | C16H27N2O15P3 |
| Molecular Weight | 580.31 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[1-(cyclohexylmethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n(CC2CCCCC2)cc1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H27N2O15P3/c19-12-11(8-30-35(26,27)33-36(28,29)32-34(23,24)25)31-14(13(12)20)10-7-18(16(22)17-15(10)21)6-9-4-2-1-3-5-9/h7,9,11-14,19-20H,1-6,8H2,(H,26,27)(H,28,29)(H,17,21,22)(H2,23,24,25)/t11-,12-,13-,14+/m1/s1 |
| InChIKey | QUGCQPFLZDJWBX-SYQHCUMBSA-N |
| XLogP | -0.38 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|