C14H23N2O16P3 — CID 146173718
[[(2R,3S,4R,5S)-5-[1-(2,2-dimethylpropanoyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146173718) has the molecular formula C14H23N2O16P3 and a molecular weight of 568.26 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[1-(2,2-dimethylpropanoyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-[1-(2,2-dimethylpropanoyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146173718 |
| Molecular Formula | C14H23N2O16P3 |
| Molecular Weight | 568.26 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[1-(2,2-dimethylpropanoyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(C)C(=O)n1cc([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N2O16P3/c1-14(2,3)12(20)16-4-6(11(19)15-13(16)21)10-9(18)8(17)7(30-10)5-29-34(25,26)32-35(27,28)31-33(22,23)24/h4,7-10,17-18H,5H2,1-3H3,(H,25,26)(H,27,28)(H,15,19,21)(H2,22,23,24)/t7-,8-,9-,10+/m1/s1 |
| InChIKey | XUPFFTPQEGLIJS-KYXWUPHJSA-N |
| XLogP | -1.27 |
| TPSA | 281.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|