C10H16BrN2O15P3 — CID 172774977
[[(2R,3S,4R,5S)-5-(6-bromo-1-methyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 172774977) has the molecular formula C10H16BrN2O15P3 and a molecular weight of 577.06 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-(6-bromo-1-methyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-(6-bromo-1-methyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 172774977 |
| Molecular Formula | C10H16BrN2O15P3 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 575.89 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-(6-bromo-1-methyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cn1c(Br)c([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16BrN2O15P3/c1-13-8(11)4(9(16)12-10(13)17)7-6(15)5(14)3(26-7)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3,5-7,14-15H,2H2,1H3,(H,21,22)(H,23,24)(H,12,16,17)(H2,18,19,20)/t3-,5-,6-,7+/m1/s1 |
| InChIKey | NLSRLFWOPNAKSW-QMTIVRBISA-N |
| XLogP | -1.66 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|