C11H19N2O15P3 — CID 172685038
[[(2R,3S,4R,5S)-5-(1,6-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 172685038) has the molecular formula C11H19N2O15P3 and a molecular weight of 512.19 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-(1,6-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-(1,6-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 172685038 |
| Molecular Formula | C11H19N2O15P3 |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-(1,6-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1c([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C11H19N2O15P3/c1-4-6(10(16)12-11(17)13(4)2)9-8(15)7(14)5(26-9)3-25-30(21,22)28-31(23,24)27-29(18,19)20/h5,7-9,14-15H,3H2,1-2H3,(H,21,22)(H,23,24)(H,12,16,17)(H2,18,19,20)/t5-,7-,8-,9+/m1/s1 |
| InChIKey | AXOHNCCYERVVTF-YYNOVJQHSA-N |
| XLogP | -2.11 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|