C11H16N3O15P3 — CID 146173775
[[(2R,3S,4R,5S)-5-[1-(cyanomethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146173775) has the molecular formula C11H16N3O15P3 and a molecular weight of 523.18 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[1-(cyanomethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-[1-(cyanomethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146173775 |
| Molecular Formula | C11H16N3O15P3 |
| Molecular Weight | 523.18 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[1-(cyanomethyl)-2,4-dioxopyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#CCn1cc([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N3O15P3/c12-1-2-14-3-5(10(17)13-11(14)18)9-8(16)7(15)6(27-9)4-26-31(22,23)29-32(24,25)28-30(19,20)21/h3,6-9,15-16H,2,4H2,(H,22,23)(H,24,25)(H,13,17,18)(H2,19,20,21)/t6-,7-,8-,9+/m1/s1 |
| InChIKey | APFUIKXIHGFHAX-BGZDPUMWSA-N |
| XLogP | -2.43 |
| TPSA | 288.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.18 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|