C10H16FN3O3 — CID 144532442
N-[(Z)-3-amino-3-methyliminoprop-1-enyl]-N-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]formamide (PubChem CID 144532442) has the molecular formula C10H16FN3O3 and a molecular weight of 245.25 g/mol. Its IUPAC name is N-[(Z)-3-amino-3-methyliminoprop-1-enyl]-N-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]formamide.
| Compound Name | N-[(Z)-3-amino-3-methyliminoprop-1-enyl]-N-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]formamide |
|---|---|
| PubChem CID | 144532442 |
| Molecular Formula | C10H16FN3O3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[(Z)-3-amino-3-methyliminoprop-1-enyl]-N-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]formamide |
| SMILES | C/N=C(N)/C=C\N(C=O)C1OC(CO)CC1F |
| InChI | InChI=1S/C10H16FN3O3/c1-13-9(12)2-3-14(6-16)10-8(11)4-7(5-15)17-10/h2-3,6-8,10,15H,4-5H2,1H3,(H2,12,13)/b3-2- |
| InChIKey | BFDALFCSXIHZHR-IHWYPQMZSA-N |
| XLogP | -0.61 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|