C5H9FO3 — CID 54034612
(3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-ol (PubChem CID 54034612) has the molecular formula C5H9FO3 and a molecular weight of 136.12 g/mol. Its IUPAC name is (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-ol.
| Compound Name | (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 54034612 |
| Molecular Formula | C5H9FO3 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-ol |
| SMILES | OC[C@@H]1C[C@H](F)C(O)O1 |
| InChI | InChI=1S/C5H9FO3/c6-4-1-3(2-7)9-5(4)8/h3-5,7-8H,1-2H2/t3-,4-,5?/m0/s1 |
| InChIKey | LIACSHZWFIOXQQ-QRHDOFTISA-N |
| XLogP | -0.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |