C6H12O4 — CID 147942620
(2S)-6-(hydroxymethyl)oxane-2,4-diol (PubChem CID 147942620) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (2S)-6-(hydroxymethyl)oxane-2,4-diol.
| Compound Name | (2S)-6-(hydroxymethyl)oxane-2,4-diol |
|---|---|
| PubChem CID | 147942620 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (2S)-6-(hydroxymethyl)oxane-2,4-diol |
| SMILES | OCC1CC(O)C[C@@H](O)O1 |
| InChI | InChI=1S/C6H12O4/c7-3-5-1-4(8)2-6(9)10-5/h4-9H,1-3H2/t4?,5?,6-/m0/s1 |
| InChIKey | IMAXLNCKOJCLPF-WRVKLSGPSA-N |
| XLogP | -1.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |