About ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol
ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol (PubChem CID 142157408) has the molecular formula C11H25NO3
and a molecular weight of 219.32 g/mol. Its IUPAC name is ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol.
Molecular Properties
| Compound Name | ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol |
| PubChem CID | 142157408 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol |
| SMILES | C=C.CC1C[C@@H](O)C[C@@H](CO)O1.CCN |
| InChI | InChI=1S/C7H14O3.C2H7N.C2H4/c1-5-2-6(9)3-7(4-8)10-5;1-2-3;1-2/h5-9H,2-4H2,1H3;2-3H2,1H3;1-2H2/t5?,6-,7+;;/m1../s1 |
| InChIKey | LOLXJNKQMLIBCS-RPHKKZDQSA-N |
| XLogP | 0.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol?
The IUPAC name of ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol (CID 142157408) is ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol.
What is the SMILES notation for ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol?
The canonical SMILES for ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol is C=C.CC1C[C@@H](O)C[C@@H](CO)O1.CCN.
What is the InChIKey of ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol?
The InChIKey is LOLXJNKQMLIBCS-RPHKKZDQSA-N. The full InChI is InChI=1S/C7H14O3.C2H7N.C2H4/c1-5-2-6(9)3-7(4-8)10-5;1-2-3;1-2/h5-9H,2-4H2,1H3;2-3H2,1H3;1-2H2/t5?,6-,7+;;/m1../s1.
What are the key properties of ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol?
ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol has a molecular weight of 219.32 g/mol, XLogP of 0.67, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;ethene;(2S,4R)-2-(hydroxymethyl)-6-methyloxan-4-ol is sourced from PubChem (CID 142157408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).