2-(4,6-dihydroxyoxan-2-yl)acetic acid

C7H12O5 — CID 77213241

IUPAC2-(4,6-dihydroxyoxan-2-yl)acetic acid
SMILESO=C(O)CC1CC(O)CC(O)O1
InChIInChI=1S/C7H12O5/c8-4-1-5(3-6(9)10)12-7(11)2-4/h4-5,7-8,11H,1-3H2,(H,9,10)
InChIKeyDWVOENPZZZFBQA-UHFFFAOYSA-N
MW176.17 g/mol
LogP-0.68
Rot. Bonds2

About 2-(4,6-dihydroxyoxan-2-yl)acetic acid

2-(4,6-dihydroxyoxan-2-yl)acetic acid (PubChem CID 77213241) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-(4,6-dihydroxyoxan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(4,6-dihydroxyoxan-2-yl)acetic acid
PubChem CID77213241
Molecular FormulaC7H12O5
Molecular Weight176.17 g/mol
Exact Mass176.07
IUPAC Name2-(4,6-dihydroxyoxan-2-yl)acetic acid
SMILESO=C(O)CC1CC(O)CC(O)O1
InChIInChI=1S/C7H12O5/c8-4-1-5(3-6(9)10)12-7(11)2-4/h4-5,7-8,11H,1-3H2,(H,9,10)
InChIKeyDWVOENPZZZFBQA-UHFFFAOYSA-N
XLogP-0.68
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 5-0.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(4,6-dihydroxyoxan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,6-dihydroxyoxan-2-yl)acetic acid?
The IUPAC name of 2-(4,6-dihydroxyoxan-2-yl)acetic acid (CID 77213241) is 2-(4,6-dihydroxyoxan-2-yl)acetic acid.
What is the SMILES notation for 2-(4,6-dihydroxyoxan-2-yl)acetic acid?
The canonical SMILES for 2-(4,6-dihydroxyoxan-2-yl)acetic acid is O=C(O)CC1CC(O)CC(O)O1.
What is the InChIKey of 2-(4,6-dihydroxyoxan-2-yl)acetic acid?
The InChIKey is DWVOENPZZZFBQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5/c8-4-1-5(3-6(9)10)12-7(11)2-4/h4-5,7-8,11H,1-3H2,(H,9,10).
What are the key properties of 2-(4,6-dihydroxyoxan-2-yl)acetic acid?
2-(4,6-dihydroxyoxan-2-yl)acetic acid has a molecular weight of 176.17 g/mol, XLogP of -0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dihydroxyoxan-2-yl)acetic acid is sourced from PubChem (CID 77213241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).