About 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid
2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 22849977) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid |
| PubChem CID | 22849977 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid |
| SMILES | C[C@H]1OC(CC#N)C[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C9H13NO4/c1-6-13-7(2-3-10)4-8(14-6)5-9(11)12/h6-8H,2,4-5H2,1H3,(H,11,12)/t6-,7?,8+/m0/s1 |
| InChIKey | LXQWFQLMAYHPEC-YPVSKDHRSA-N |
| XLogP | 0.89 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid?
The IUPAC name of 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid (CID 22849977) is 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid.
What is the SMILES notation for 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid?
The canonical SMILES for 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid is C[C@H]1OC(CC#N)C[C@H](CC(=O)O)O1.
What is the InChIKey of 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid?
The InChIKey is LXQWFQLMAYHPEC-YPVSKDHRSA-N. The full InChI is InChI=1S/C9H13NO4/c1-6-13-7(2-3-10)4-8(14-6)5-9(11)12/h6-8H,2,4-5H2,1H3,(H,11,12)/t6-,7?,8+/m0/s1.
What are the key properties of 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid?
2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid has a molecular weight of 199.21 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4R)-6-(cyanomethyl)-2-methyl-1,3-dioxan-4-yl]acetic acid is sourced from PubChem (CID 22849977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).