C16H22Cl2O6 — CID 168895888
(4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane (PubChem CID 168895888) has the molecular formula C16H22Cl2O6 and a molecular weight of 381.25 g/mol. Its IUPAC name is (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane.
| Compound Name | (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane |
|---|---|
| PubChem CID | 168895888 |
| Molecular Formula | C16H22Cl2O6 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane |
| SMILES | CC.COc1c(Cl)ccc(Cl)c1C(=O)OCC1CC(O)CC(O)O1 |
| InChI | InChI=1S/C14H16Cl2O6.C2H6/c1-20-13-10(16)3-2-9(15)12(13)14(19)21-6-8-4-7(17)5-11(18)22-8;1-2/h2-3,7-8,11,17-18H,4-6H2,1H3;1-2H3 |
| InChIKey | DYBCALOFHBPPOQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |