About (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane
(4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane (PubChem CID 168895888) has the molecular formula C16H22Cl2O6
and a molecular weight of 381.25 g/mol. Its IUPAC name is (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane.
Molecular Properties
| Compound Name | (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane |
| PubChem CID | 168895888 |
| Molecular Formula | C16H22Cl2O6 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane |
| SMILES | CC.COc1c(Cl)ccc(Cl)c1C(=O)OCC1CC(O)CC(O)O1 |
| InChI | InChI=1S/C14H16Cl2O6.C2H6/c1-20-13-10(16)3-2-9(15)12(13)14(19)21-6-8-4-7(17)5-11(18)22-8;1-2/h2-3,7-8,11,17-18H,4-6H2,1H3;1-2H3 |
| InChIKey | DYBCALOFHBPPOQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane?
The IUPAC name of (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane (CID 168895888) is (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane.
What is the SMILES notation for (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane?
The canonical SMILES for (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane is CC.COc1c(Cl)ccc(Cl)c1C(=O)OCC1CC(O)CC(O)O1.
What is the InChIKey of (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane?
The InChIKey is DYBCALOFHBPPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2O6.C2H6/c1-20-13-10(16)3-2-9(15)12(13)14(19)21-6-8-4-7(17)5-11(18)22-8;1-2/h2-3,7-8,11,17-18H,4-6H2,1H3;1-2H3.
What are the key properties of (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane?
(4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane has a molecular weight of 381.25 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dihydroxyoxan-2-yl)methyl 3,6-dichloro-2-methoxybenzoate;ethane is sourced from PubChem (CID 168895888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).