C12H12F4O2 — CID 123937249
[4-fluoro-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methanol (PubChem CID 123937249) has the molecular formula C12H12F4O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is [4-fluoro-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methanol.
| Compound Name | [4-fluoro-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 123937249 |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [4-fluoro-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methanol |
| SMILES | OCC1CC(F)C(c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C12H12F4O2/c13-10-5-9(6-17)18-11(10)7-1-3-8(4-2-7)12(14,15)16/h1-4,9-11,17H,5-6H2 |
| InChIKey | HJRQUSHIRMCWFX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |