C12H12F3IO — CID 125456778
(2S,4R)-2-(iodomethyl)-4-[4-(trifluoromethyl)phenyl]oxolane (PubChem CID 125456778) has the molecular formula C12H12F3IO and a molecular weight of 356.13 g/mol. Its IUPAC name is (2S,4R)-2-(iodomethyl)-4-[4-(trifluoromethyl)phenyl]oxolane.
| Compound Name | (2S,4R)-2-(iodomethyl)-4-[4-(trifluoromethyl)phenyl]oxolane |
|---|---|
| PubChem CID | 125456778 |
| Molecular Formula | C12H12F3IO |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | (2S,4R)-2-(iodomethyl)-4-[4-(trifluoromethyl)phenyl]oxolane |
| SMILES | FC(F)(F)c1ccc([C@@H]2CO[C@H](CI)C2)cc1 |
| InChI | InChI=1S/C12H12F3IO/c13-12(14,15)10-3-1-8(2-4-10)9-5-11(6-16)17-7-9/h1-4,9,11H,5-7H2/t9-,11-/m0/s1 |
| InChIKey | RJVSWVCYABMCSU-ONGXEEELSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|