C14H17F3 — CID 118423626
1-[(3R)-3,4-dimethylcyclopentyl]-4-(trifluoromethyl)benzene (PubChem CID 118423626) has the molecular formula C14H17F3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-[(3R)-3,4-dimethylcyclopentyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(3R)-3,4-dimethylcyclopentyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118423626 |
| Molecular Formula | C14H17F3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[(3R)-3,4-dimethylcyclopentyl]-4-(trifluoromethyl)benzene |
| SMILES | CC1CC(c2ccc(C(F)(F)F)cc2)C[C@H]1C |
| InChI | InChI=1S/C14H17F3/c1-9-7-12(8-10(9)2)11-3-5-13(6-4-11)14(15,16)17/h3-6,9-10,12H,7-8H2,1-2H3/t9-,10?,12?/m1/s1 |
| InChIKey | CRZCLXXYKDYROG-GRZMOONWSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |