C16H22F3N — CID 175550564
(2R)-1-tert-butyl-2-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 175550564) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-1-tert-butyl-2-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | (2R)-1-tert-butyl-2-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 175550564 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2R)-1-tert-butyl-2-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | C[C@@H]1CC(c2ccc(C(F)(F)F)cc2)CN1C(C)(C)C |
| InChI | InChI=1S/C16H22F3N/c1-11-9-13(10-20(11)15(2,3)4)12-5-7-14(8-6-12)16(17,18)19/h5-8,11,13H,9-10H2,1-4H3/t11-,13?/m1/s1 |
| InChIKey | WYWBEGONUICWHG-JTDNENJMSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |