C12H14F3NO — CID 139610708
N-[[3-[4-(trifluoromethyl)phenyl]cyclobutyl]methyl]hydroxylamine (PubChem CID 139610708) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[[3-[4-(trifluoromethyl)phenyl]cyclobutyl]methyl]hydroxylamine.
| Compound Name | N-[[3-[4-(trifluoromethyl)phenyl]cyclobutyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 139610708 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-[[3-[4-(trifluoromethyl)phenyl]cyclobutyl]methyl]hydroxylamine |
| SMILES | ONCC1CC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C12H14F3NO/c13-12(14,15)11-3-1-9(2-4-11)10-5-8(6-10)7-16-17/h1-4,8,10,16-17H,5-7H2 |
| InChIKey | HLZXGAALHOGKKW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|