C17H19F3N2O2 — CID 155937668
N-[2-(prop-2-enoylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide (PubChem CID 155937668) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[2-(prop-2-enoylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | N-[2-(prop-2-enoylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155937668 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[2-(prop-2-enoylamino)ethyl]-3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide |
| SMILES | C=CC(=O)NCCNC(=O)C1CC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-2-15(23)21-7-8-22-16(24)13-9-12(10-13)11-3-5-14(6-4-11)17(18,19)20/h2-6,12-13H,1,7-10H2,(H,21,23)(H,22,24) |
| InChIKey | BXSQQZNZHOAYTC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|