C9H8F3NOS — CID 139018855
N-[[2-(trifluoromethyl)thiophen-3-yl]methyl]prop-2-enamide (PubChem CID 139018855) has the molecular formula C9H8F3NOS and a molecular weight of 235.23 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)thiophen-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[2-(trifluoromethyl)thiophen-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 139018855 |
| Molecular Formula | C9H8F3NOS |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | N-[[2-(trifluoromethyl)thiophen-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccsc1C(F)(F)F |
| InChI | InChI=1S/C9H8F3NOS/c1-2-7(14)13-5-6-3-4-15-8(6)9(10,11)12/h2-4H,1,5H2,(H,13,14) |
| InChIKey | VZCIVNHHQDMMEZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|