C10H11NO3S — CID 166414579
methyl 3-[(prop-2-enoylamino)methyl]thiophene-2-carboxylate (PubChem CID 166414579) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is methyl 3-[(prop-2-enoylamino)methyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(prop-2-enoylamino)methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 166414579 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | methyl 3-[(prop-2-enoylamino)methyl]thiophene-2-carboxylate |
| SMILES | C=CC(=O)NCc1ccsc1C(=O)OC |
| InChI | InChI=1S/C10H11NO3S/c1-3-8(12)11-6-7-4-5-15-9(7)10(13)14-2/h3-5H,1,6H2,2H3,(H,11,12) |
| InChIKey | GKAUTRZHCQUXSM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|