C14H16BrNO4S2 — CID 157354994
methyl 3-(aminomethyl)thiophene-2-carboxylate;methyl 3-(bromomethyl)thiophene-2-carboxylate (PubChem CID 157354994) has the molecular formula C14H16BrNO4S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is methyl 3-(aminomethyl)thiophene-2-carboxylate;methyl 3-(bromomethyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(aminomethyl)thiophene-2-carboxylate;methyl 3-(bromomethyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 157354994 |
| Molecular Formula | C14H16BrNO4S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | methyl 3-(aminomethyl)thiophene-2-carboxylate;methyl 3-(bromomethyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1CBr.COC(=O)c1sccc1CN |
| InChI | InChI=1S/C7H7BrO2S.C7H9NO2S/c2*1-10-7(9)6-5(4-8)2-3-11-6/h2-3H,4H2,1H3;2-3H,4,8H2,1H3 |
| InChIKey | BHZASVLLFLWDEA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|