C16H18F3NO3 — CID 120672387
4-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672387) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672387 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3NO3/c17-16(18,19)13-7-1-10(2-8-13)9-20-14(21)11-3-5-12(6-4-11)15(22)23/h1-2,7-8,11-12H,3-6,9H2,(H,20,21)(H,22,23) |
| InChIKey | PCYGGOKTTKZICB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |