C20H20F4N2O3S — CID 27052613
1-(4-fluorophenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 27052613) has the molecular formula C20H20F4N2O3S and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27052613 |
| Molecular Formula | C20H20F4N2O3S |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H20F4N2O3S/c21-17-5-7-18(8-6-17)30(28,29)26-11-9-15(10-12-26)19(27)25-13-14-1-3-16(4-2-14)20(22,23)24/h1-8,15H,9-13H2,(H,25,27) |
| InChIKey | UCDTYDXHTBPVCA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |