C20H20F3N3O5S — CID 60535715
N-[(4-nitrophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 60535715) has the molecular formula C20H20F3N3O5S and a molecular weight of 471.46 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-nitrophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60535715 |
| Molecular Formula | C20H20F3N3O5S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[(4-nitrophenyl)methyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc([N+](=O)[O-])cc1)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H20F3N3O5S/c21-20(22,23)16-2-1-3-18(12-16)32(30,31)25-10-8-15(9-11-25)19(27)24-13-14-4-6-17(7-5-14)26(28)29/h1-7,12,15H,8-11,13H2,(H,24,27) |
| InChIKey | LFFVDJCSJPBRPI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|