C18H29F3N4O5 — CID 142864403
ethane;N-[(Z)-5-[formyl-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-4-(N'-methylcarbamimidoyl)pent-4-en-2-ynyl]formamide;1,1,1-trifluoroethane (PubChem CID 142864403) has the molecular formula C18H29F3N4O5 and a molecular weight of 438.45 g/mol. Its IUPAC name is ethane;N-[(Z)-5-[formyl-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-4-(N'-methylcarbamimidoyl)pent-4-en-2-ynyl]formamide;1,1,1-trifluoroethane.
| Compound Name | ethane;N-[(Z)-5-[formyl-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-4-(N'-methylcarbamimidoyl)pent-4-en-2-ynyl]formamide;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 142864403 |
| Molecular Formula | C18H29F3N4O5 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | ethane;N-[(Z)-5-[formyl-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]-4-(N'-methylcarbamimidoyl)pent-4-en-2-ynyl]formamide;1,1,1-trifluoroethane |
| SMILES | C/N=C(N)/C(C#CCNC=O)=C\N(C=O)C1CC(O)C(CO)O1.CC.CC(F)(F)F |
| InChI | InChI=1S/C14H20N4O5.C2H3F3.C2H6/c1-16-14(15)10(3-2-4-17-8-20)6-18(9-21)13-5-11(22)12(7-19)23-13;1-2(3,4)5;1-2/h6,8-9,11-13,19,22H,4-5,7H2,1H3,(H2,15,16)(H,17,20);1H3;1-2H3/b10-6-;; |
| InChIKey | KDVFHYKUYNASHH-LVLXLXDWSA-N |
| XLogP | 0.13 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|