C9H13ClN2O5 — CID 46941506
(Z)-3-[[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-formylamino]prop-2-enamide (PubChem CID 46941506) has the molecular formula C9H13ClN2O5 and a molecular weight of 264.67 g/mol. Its IUPAC name is (Z)-3-[[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-formylamino]prop-2-enamide.
| Compound Name | (Z)-3-[[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-formylamino]prop-2-enamide |
|---|---|
| PubChem CID | 46941506 |
| Molecular Formula | C9H13ClN2O5 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (Z)-3-[[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-formylamino]prop-2-enamide |
| SMILES | NC(=O)/C=C\N(C=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C9H13ClN2O5/c10-7-8(16)5(3-13)17-9(7)12(4-14)2-1-6(11)15/h1-2,4-5,7-9,13,16H,3H2,(H2,11,15)/b2-1-/t5-,7+,8-,9-/m1/s1 |
| InChIKey | OYEBTRZCSHZLMP-JHRPQGOOSA-N |
| XLogP | -1.87 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|