C30H40N3O8P — CID 130462097
propan-2-yl (2S)-2-[[[4-(4-methoxyphenyl)phenoxy]-[[4-methyl-5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methoxy]phosphanyl]amino]propanoate (PubChem CID 130462097) has the molecular formula C30H40N3O8P and a molecular weight of 601.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[4-(4-methoxyphenyl)phenoxy]-[[4-methyl-5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methoxy]phosphanyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[4-(4-methoxyphenyl)phenoxy]-[[4-methyl-5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methoxy]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 130462097 |
| Molecular Formula | C30H40N3O8P |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[[4-(4-methoxyphenyl)phenoxy]-[[4-methyl-5-[methylcarbamoyl-[(Z)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methoxy]phosphanyl]amino]propanoate |
| SMILES | CNC(=O)N(/C=C\C=O)C1OC(COP(N[C@@H](C)C(=O)OC(C)C)Oc2ccc(-c3ccc(OC)cc3)cc2)CC1C |
| InChI | InChI=1S/C30H40N3O8P/c1-20(2)39-29(35)22(4)32-42(41-26-14-10-24(11-15-26)23-8-12-25(37-6)13-9-23)38-19-27-18-21(3)28(40-27)33(16-7-17-34)30(36)31-5/h7-17,20-22,27-28,32H,18-19H2,1-6H3,(H,31,36)/b16-7-/t21?,22-,27?,28?,42?/m0/s1 |
| InChIKey | RHAYJTMFDCJSAR-GLKWCFSKSA-N |
| XLogP | 5.02 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|