C20H25N2O6P — CID 168931450
propan-2-yl (2R)-2-[[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 168931450) has the molecular formula C20H25N2O6P and a molecular weight of 420.40 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 168931450 |
| Molecular Formula | C20H25N2O6P |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | propan-2-yl (2R)-2-[[(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | Cc1ncc(COP(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)c(C=O)c1O |
| InChI | InChI=1S/C20H25N2O6P/c1-13(2)27-20(25)15(4)22-29(28-17-8-6-5-7-9-17)26-12-16-10-21-14(3)19(24)18(16)11-23/h5-11,13,15,22,24H,12H2,1-4H3/t15-,29?/m1/s1 |
| InChIKey | ZUMPVGSKHLOVFO-YHVXIASJSA-N |
| XLogP | 3.66 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|