C22H30N3O7P — CID 144948883
propan-2-yl 2-[[[(E)-[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-ylidene]methoxy]-phenoxyphosphanyl]amino]propanoate (PubChem CID 144948883) has the molecular formula C22H30N3O7P and a molecular weight of 479.47 g/mol. Its IUPAC name is propan-2-yl 2-[[[(E)-[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-ylidene]methoxy]-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(E)-[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-ylidene]methoxy]-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144948883 |
| Molecular Formula | C22H30N3O7P |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | propan-2-yl 2-[[[(E)-[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-ylidene]methoxy]-phenoxyphosphanyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(O/C=C1\CCC(N(C)/C=C\C(=O)NC=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N3O7P/c1-16(2)30-22(28)17(3)24-33(32-18-8-6-5-7-9-18)29-14-19-10-11-21(31-19)25(4)13-12-20(27)23-15-26/h5-9,12-17,21,24H,10-11H2,1-4H3,(H,23,26,27)/b13-12-,19-14+ |
| InChIKey | JFOLCYUJWBWXGH-KMCOKLRBSA-N |
| XLogP | 2.93 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|